C15H19N3O2S — CID 3151029
4-methyl-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)pentanoic acid (PubChem CID 3151029) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 4-methyl-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)pentanoic acid.
| Compound Name | 4-methyl-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 3151029 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-methyl-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)pentanoic acid |
| SMILES | CC(C)CC(Nc1ncnc2sc3c(c12)CCC3)C(=O)O |
| InChI | InChI=1S/C15H19N3O2S/c1-8(2)6-10(15(19)20)18-13-12-9-4-3-5-11(9)21-14(12)17-7-16-13/h7-8,10H,3-6H2,1-2H3,(H,19,20)(H,16,17,18) |
| InChIKey | SBAPFBZXXVHJOS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |