C28H38N4O4 — CID 31510549
N-[4-[[(S)-(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]-4-oxobutyl]adamantane-1-carboxamide (PubChem CID 31510549) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is N-[4-[[(S)-(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]-4-oxobutyl]adamantane-1-carboxamide.
| Compound Name | N-[4-[[(S)-(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]-4-oxobutyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 31510549 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | N-[4-[[(S)-(3,5-dimethoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]-4-oxobutyl]adamantane-1-carboxamide |
| SMILES | COc1cc(OC)cc([C@H](NC(=O)CCCNC(=O)C23CC4CC(CC(C4)C2)C3)c2nccn2C)c1 |
| InChI | InChI=1S/C28H38N4O4/c1-32-8-7-29-26(32)25(21-12-22(35-2)14-23(13-21)36-3)31-24(33)5-4-6-30-27(34)28-15-18-9-19(16-28)11-20(10-18)17-28/h7-8,12-14,18-20,25H,4-6,9-11,15-17H2,1-3H3,(H,30,34)(H,31,33)/t18?,19?,20?,25-,28?/m0/s1 |
| InChIKey | RTFSXOLISHVCPJ-CZILXDHESA-N |
| XLogP | 3.76 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|