C5H6N6O2 — CID 3151193
5-oxa-2,4,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3,6-dien-11-one (PubChem CID 3151193) has the molecular formula C5H6N6O2 and a molecular weight of 182.14 g/mol. Its IUPAC name is 5-oxa-2,4,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3,6-dien-11-one.
| Compound Name | 5-oxa-2,4,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3,6-dien-11-one |
|---|---|
| PubChem CID | 3151193 |
| Molecular Formula | C5H6N6O2 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 5-oxa-2,4,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-3,6-dien-11-one |
| SMILES | O=C1NC2Nc3nonc3NC2N1 |
| InChI | InChI=1S/C5H6N6O2/c12-5-8-1-2(9-5)7-4-3(6-1)10-13-11-4/h1-2H,(H,6,10)(H,7,11)(H2,8,9,12) |
| InChIKey | YLXCBAFUMLKMFK-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |