C9H7Cl2N5O — CID 3151927
3-N-[(2,4-dichlorophenyl)methylideneamino]-1,2,5-oxadiazole-3,4-diamine (PubChem CID 3151927) has the molecular formula C9H7Cl2N5O and a molecular weight of 272.10 g/mol. Its IUPAC name is 3-N-[(2,4-dichlorophenyl)methylideneamino]-1,2,5-oxadiazole-3,4-diamine.
| Compound Name | 3-N-[(2,4-dichlorophenyl)methylideneamino]-1,2,5-oxadiazole-3,4-diamine |
|---|---|
| PubChem CID | 3151927 |
| Molecular Formula | C9H7Cl2N5O |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 3-N-[(2,4-dichlorophenyl)methylideneamino]-1,2,5-oxadiazole-3,4-diamine |
| SMILES | Nc1nonc1NN=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H7Cl2N5O/c10-6-2-1-5(7(11)3-6)4-13-14-9-8(12)15-17-16-9/h1-4H,(H2,12,15)(H,14,16) |
| InChIKey | HEDZUFBPNWRAIE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|