C16H13N5O — CID 31520219
3-cyano-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzamide (PubChem CID 31520219) has the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-cyano-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzamide.
| Compound Name | 3-cyano-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzamide |
|---|---|
| PubChem CID | 31520219 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-cyano-N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)benzamide |
| SMILES | Cc1nn(C)c2ncc(NC(=O)c3cccc(C#N)c3)cc12 |
| InChI | InChI=1S/C16H13N5O/c1-10-14-7-13(9-18-15(14)21(2)20-10)19-16(22)12-5-3-4-11(6-12)8-17/h3-7,9H,1-2H3,(H,19,22) |
| InChIKey | POFSXMVKAQXNTB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |