C19H24N6O3 — CID 31520275
N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 31520275) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 31520275 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | Cc1nn(C)c2ncc(NC(=O)CN3C(=O)N[C@]4(CCCC[C@H]4C)C3=O)cc12 |
| InChI | InChI=1S/C19H24N6O3/c1-11-6-4-5-7-19(11)17(27)25(18(28)22-19)10-15(26)21-13-8-14-12(2)23-24(3)16(14)20-9-13/h8-9,11H,4-7,10H2,1-3H3,(H,21,26)(H,22,28)/t11-,19+/m1/s1 |
| InChIKey | GYTQWPYBCZZBNW-WYRIXSBYSA-N |
| XLogP | 1.72 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|