About N'-ethyl-N'-phenylpropane-1,3-diamine
N'-ethyl-N'-phenylpropane-1,3-diamine (PubChem CID 3152197) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is N'-ethyl-N'-phenylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-ethyl-N'-phenylpropane-1,3-diamine |
| PubChem CID | 3152197 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N'-ethyl-N'-phenylpropane-1,3-diamine |
| SMILES | CCN(CCCN)c1ccccc1 |
| InChI | InChI=1S/C11H18N2/c1-2-13(10-6-9-12)11-7-4-3-5-8-11/h3-5,7-8H,2,6,9-10,12H2,1H3 |
| InChIKey | GHGKUGQRRXYXEJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-ethyl-N'-phenylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-phenylpropane-1,3-diamine?
The IUPAC name of N'-ethyl-N'-phenylpropane-1,3-diamine (CID 3152197) is N'-ethyl-N'-phenylpropane-1,3-diamine.
What is the SMILES notation for N'-ethyl-N'-phenylpropane-1,3-diamine?
The canonical SMILES for N'-ethyl-N'-phenylpropane-1,3-diamine is CCN(CCCN)c1ccccc1.
What is the InChIKey of N'-ethyl-N'-phenylpropane-1,3-diamine?
The InChIKey is GHGKUGQRRXYXEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-2-13(10-6-9-12)11-7-4-3-5-8-11/h3-5,7-8H,2,6,9-10,12H2,1H3.
What are the key properties of N'-ethyl-N'-phenylpropane-1,3-diamine?
N'-ethyl-N'-phenylpropane-1,3-diamine has a molecular weight of 178.28 g/mol, XLogP of 1.86, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-phenylpropane-1,3-diamine is sourced from PubChem (CID 3152197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).