About N,N'-bis(1,1-dioxothiolan-3-yl)oxamide
N,N'-bis(1,1-dioxothiolan-3-yl)oxamide (PubChem CID 3152339) has the molecular formula C10H16N2O6S2
and a molecular weight of 324.38 g/mol. Its IUPAC name is N,N'-bis(1,1-dioxothiolan-3-yl)oxamide.
Molecular Properties
| Compound Name | N,N'-bis(1,1-dioxothiolan-3-yl)oxamide |
| PubChem CID | 3152339 |
| Molecular Formula | C10H16N2O6S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | N,N'-bis(1,1-dioxothiolan-3-yl)oxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H16N2O6S2/c13-9(11-7-1-3-19(15,16)5-7)10(14)12-8-2-4-20(17,18)6-8/h7-8H,1-6H2,(H,11,13)(H,12,14) |
| InChIKey | HVUDWKHJTKASIX-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(1,1-dioxothiolan-3-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(1,1-dioxothiolan-3-yl)oxamide?
The IUPAC name of N,N'-bis(1,1-dioxothiolan-3-yl)oxamide (CID 3152339) is N,N'-bis(1,1-dioxothiolan-3-yl)oxamide.
What is the SMILES notation for N,N'-bis(1,1-dioxothiolan-3-yl)oxamide?
The canonical SMILES for N,N'-bis(1,1-dioxothiolan-3-yl)oxamide is O=C(NC1CCS(=O)(=O)C1)C(=O)NC1CCS(=O)(=O)C1.
What is the InChIKey of N,N'-bis(1,1-dioxothiolan-3-yl)oxamide?
The InChIKey is HVUDWKHJTKASIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O6S2/c13-9(11-7-1-3-19(15,16)5-7)10(14)12-8-2-4-20(17,18)6-8/h7-8H,1-6H2,(H,11,13)(H,12,14).
What are the key properties of N,N'-bis(1,1-dioxothiolan-3-yl)oxamide?
N,N'-bis(1,1-dioxothiolan-3-yl)oxamide has a molecular weight of 324.38 g/mol, XLogP of -2.41, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(1,1-dioxothiolan-3-yl)oxamide is sourced from PubChem (CID 3152339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).