C10H19NO2S — CID 3152340
N-cyclohexyl-1,1-dioxothiolan-3-amine (PubChem CID 3152340) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is N-cyclohexyl-1,1-dioxothiolan-3-amine.
| Compound Name | N-cyclohexyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 3152340 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-cyclohexyl-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CCC(NC2CCCCC2)C1 |
| InChI | InChI=1S/C10H19NO2S/c12-14(13)7-6-10(8-14)11-9-4-2-1-3-5-9/h9-11H,1-8H2 |
| InChIKey | OHSNGEHDOIRAAE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |