C22H29N2O2+ — CID 3152525
(2,4-dimethylphenyl)methyl-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-dimethylazanium (PubChem CID 3152525) has the molecular formula C22H29N2O2+ and a molecular weight of 353.49 g/mol. Its IUPAC name is (2,4-dimethylphenyl)methyl-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-dimethylazanium.
| Compound Name | (2,4-dimethylphenyl)methyl-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 3152525 |
| Molecular Formula | C22H29N2O2+ |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | (2,4-dimethylphenyl)methyl-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-dimethylazanium |
| SMILES | Cc1ccc(C[N+](C)(C)CCN2C(=O)C3C4C=CC(C4)C3C2=O)c(C)c1 |
| InChI | InChI=1S/C22H29N2O2/c1-14-5-6-18(15(2)11-14)13-24(3,4)10-9-23-21(25)19-16-7-8-17(12-16)20(19)22(23)26/h5-8,11,16-17,19-20H,9-10,12-13H2,1-4H3/q+1 |
| InChIKey | LUQPFONOBDQFCQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|