C15H20N2 — CID 3152573
1,3-bis(prop-2-enyl)-1,2,3,4-tetrahydroisoquinolin-5-amine (PubChem CID 3152573) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1,3-bis(prop-2-enyl)-1,2,3,4-tetrahydroisoquinolin-5-amine.
| Compound Name | 1,3-bis(prop-2-enyl)-1,2,3,4-tetrahydroisoquinolin-5-amine |
|---|---|
| PubChem CID | 3152573 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1,3-bis(prop-2-enyl)-1,2,3,4-tetrahydroisoquinolin-5-amine |
| SMILES | C=CCC1Cc2c(N)cccc2C(CC=C)N1 |
| InChI | InChI=1S/C15H20N2/c1-3-6-11-10-13-12(8-5-9-14(13)16)15(17-11)7-4-2/h3-5,8-9,11,15,17H,1-2,6-7,10,16H2 |
| InChIKey | BTXLHLDPUHBVCS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|