About [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate
[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate (PubChem CID 31532211) has the molecular formula C22H19N3O5S
and a molecular weight of 437.48 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate.
Molecular Properties
| Compound Name | [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate |
| PubChem CID | 31532211 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate |
| SMILES | O=C(OCc1noc(-c2ccco2)n1)c1cc(-c2ccccc2)c(N2CCOCC2)s1 |
| InChI | InChI=1S/C22H19N3O5S/c26-22(29-14-19-23-20(30-24-19)17-7-4-10-28-17)18-13-16(15-5-2-1-3-6-15)21(31-18)25-8-11-27-12-9-25/h1-7,10,13H,8-9,11-12,14H2 |
| InChIKey | HEMPVIYCVFFGLA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 90.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate?
The IUPAC name of [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate (CID 31532211) is [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate.
What is the SMILES notation for [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate?
The canonical SMILES for [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate is O=C(OCc1noc(-c2ccco2)n1)c1cc(-c2ccccc2)c(N2CCOCC2)s1.
What is the InChIKey of [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate?
The InChIKey is HEMPVIYCVFFGLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O5S/c26-22(29-14-19-23-20(30-24-19)17-7-4-10-28-17)18-13-16(15-5-2-1-3-6-15)21(31-18)25-8-11-27-12-9-25/h1-7,10,13H,8-9,11-12,14H2.
What are the key properties of [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate?
[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate has a molecular weight of 437.48 g/mol, XLogP of 4.25, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methyl 5-morpholin-4-yl-4-phenylthiophene-2-carboxylate is sourced from PubChem (CID 31532211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).