About 4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one
4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one (PubChem CID 31534088) has the molecular formula C18H13Cl2N3O3S
and a molecular weight of 422.29 g/mol. Its IUPAC name is 4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one |
| PubChem CID | 31534088 |
| Molecular Formula | C18H13Cl2N3O3S |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1-c1ccc(S(=O)(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H13Cl2N3O3S/c19-15-11-21-23(18(24)17(15)20)13-5-7-14(8-6-13)27(25,26)22-10-9-12-3-1-2-4-16(12)22/h1-8,11H,9-10H2 |
| InChIKey | MNKBEMSAGWLVBH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one?
The IUPAC name of 4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one (CID 31534088) is 4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one.
What is the SMILES notation for 4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one?
The canonical SMILES for 4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one is O=c1c(Cl)c(Cl)cnn1-c1ccc(S(=O)(=O)N2CCc3ccccc32)cc1.
What is the InChIKey of 4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one?
The InChIKey is MNKBEMSAGWLVBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2N3O3S/c19-15-11-21-23(18(24)17(15)20)13-5-7-14(8-6-13)27(25,26)22-10-9-12-3-1-2-4-16(12)22/h1-8,11H,9-10H2.
What are the key properties of 4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one?
4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one has a molecular weight of 422.29 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]pyridazin-3-one is sourced from PubChem (CID 31534088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).