C19H24N2O5S2 — CID 31534702
4-methylsulfonyl-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 31534702) has the molecular formula C19H24N2O5S2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 4-methylsulfonyl-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-methylsulfonyl-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 31534702 |
| Molecular Formula | C19H24N2O5S2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 4-methylsulfonyl-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)NCc2ccccc2CN2CCOCC2)cc1 |
| InChI | InChI=1S/C19H24N2O5S2/c1-27(22,23)18-6-8-19(9-7-18)28(24,25)20-14-16-4-2-3-5-17(16)15-21-10-12-26-13-11-21/h2-9,20H,10-15H2,1H3 |
| InChIKey | DUTDRWXBYXPXIT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |