About methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate
methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate (PubChem CID 31535517) has the molecular formula C14H18N4O2
and a molecular weight of 274.32 g/mol. Its IUPAC name is methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate |
| PubChem CID | 31535517 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2nnc(C)c(C)c2C#N)CC1 |
| InChI | InChI=1S/C14H18N4O2/c1-9-10(2)16-17-13(12(9)8-15)18-6-4-11(5-7-18)14(19)20-3/h11H,4-7H2,1-3H3 |
| InChIKey | UUKZMYGZDQWPDL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 79.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate?
The IUPAC name of methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate (CID 31535517) is methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate.
What is the SMILES notation for methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate?
The canonical SMILES for methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate is COC(=O)C1CCN(c2nnc(C)c(C)c2C#N)CC1.
What is the InChIKey of methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate?
The InChIKey is UUKZMYGZDQWPDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2/c1-9-10(2)16-17-13(12(9)8-15)18-6-4-11(5-7-18)14(19)20-3/h11H,4-7H2,1-3H3.
What are the key properties of methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate?
methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate has a molecular weight of 274.32 g/mol, XLogP of 1.35, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(4-cyano-5,6-dimethylpyridazin-3-yl)piperidine-4-carboxylate is sourced from PubChem (CID 31535517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).