About methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate
methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate (PubChem CID 3153582) has the molecular formula C14H10N4O5
and a molecular weight of 314.26 g/mol. Its IUPAC name is methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate |
| PubChem CID | 3153582 |
| Molecular Formula | C14H10N4O5 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ccc([N+](=O)[O-])c3nonc23)cc1 |
| InChI | InChI=1S/C14H10N4O5/c1-22-14(19)8-2-4-9(5-3-8)15-10-6-7-11(18(20)21)13-12(10)16-23-17-13/h2-7,15H,1H3 |
| InChIKey | GVIVYINOSAKYQJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate?
The IUPAC name of methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate (CID 3153582) is methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate.
What is the SMILES notation for methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate?
The canonical SMILES for methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate is COC(=O)c1ccc(Nc2ccc([N+](=O)[O-])c3nonc23)cc1.
What is the InChIKey of methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate?
The InChIKey is GVIVYINOSAKYQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O5/c1-22-14(19)8-2-4-9(5-3-8)15-10-6-7-11(18(20)21)13-12(10)16-23-17-13/h2-7,15H,1H3.
What are the key properties of methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate?
methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate has a molecular weight of 314.26 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzoate is sourced from PubChem (CID 3153582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).