About N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide
N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide (PubChem CID 3153584) has the molecular formula C14H11N5O4
and a molecular weight of 313.27 g/mol. Its IUPAC name is N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide |
| PubChem CID | 3153584 |
| Molecular Formula | C14H11N5O4 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2ccc3nonc3c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H11N5O4/c1-8(20)15-9-2-4-10(5-3-9)16-12-7-6-11-13(18-23-17-11)14(12)19(21)22/h2-7,16H,1H3,(H,15,20) |
| InChIKey | TUIVQEWDJKNEGN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide?
The IUPAC name of N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide (CID 3153584) is N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide.
What is the SMILES notation for N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide?
The canonical SMILES for N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide is CC(=O)Nc1ccc(Nc2ccc3nonc3c2[N+](=O)[O-])cc1.
What is the InChIKey of N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide?
The InChIKey is TUIVQEWDJKNEGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N5O4/c1-8(20)15-9-2-4-10(5-3-9)16-12-7-6-11-13(18-23-17-11)14(12)19(21)22/h2-7,16H,1H3,(H,15,20).
What are the key properties of N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide?
N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide has a molecular weight of 313.27 g/mol, XLogP of 2.83, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(4-nitro-2,1,3-benzoxadiazol-5-yl)amino]phenyl]acetamide is sourced from PubChem (CID 3153584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).