About 3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile
3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile (PubChem CID 31535943) has the molecular formula C13H9Cl2N3O
and a molecular weight of 294.14 g/mol. Its IUPAC name is 3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile |
| PubChem CID | 31535943 |
| Molecular Formula | C13H9Cl2N3O |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile |
| SMILES | Cc1nnc(Oc2cc(Cl)cc(Cl)c2)c(C#N)c1C |
| InChI | InChI=1S/C13H9Cl2N3O/c1-7-8(2)17-18-13(12(7)6-16)19-11-4-9(14)3-10(15)5-11/h3-5H,1-2H3 |
| InChIKey | UKSPPYHOBREMQZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile?
The IUPAC name of 3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile (CID 31535943) is 3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile.
What is the SMILES notation for 3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile?
The canonical SMILES for 3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile is Cc1nnc(Oc2cc(Cl)cc(Cl)c2)c(C#N)c1C.
What is the InChIKey of 3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile?
The InChIKey is UKSPPYHOBREMQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2N3O/c1-7-8(2)17-18-13(12(7)6-16)19-11-4-9(14)3-10(15)5-11/h3-5H,1-2H3.
What are the key properties of 3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile?
3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile has a molecular weight of 294.14 g/mol, XLogP of 4.06, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dichlorophenoxy)-5,6-dimethylpyridazine-4-carbonitrile is sourced from PubChem (CID 31535943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).