About N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide
N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide (PubChem CID 3153700) has the molecular formula C16H19N3O3
and a molecular weight of 301.35 g/mol. Its IUPAC name is N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide.
Molecular Properties
| Compound Name | N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide |
| PubChem CID | 3153700 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide |
| SMILES | Cc1cc(NC(=O)CCCC(=O)NCc2ccccc2)no1 |
| InChI | InChI=1S/C16H19N3O3/c1-12-10-14(19-22-12)18-16(21)9-5-8-15(20)17-11-13-6-3-2-4-7-13/h2-4,6-7,10H,5,8-9,11H2,1H3,(H,17,20)(H,18,19,21) |
| InChIKey | HKBGUFIMMBOILW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide?
The IUPAC name of N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide (CID 3153700) is N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide.
What is the SMILES notation for N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide?
The canonical SMILES for N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide is Cc1cc(NC(=O)CCCC(=O)NCc2ccccc2)no1.
What is the InChIKey of N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide?
The InChIKey is HKBGUFIMMBOILW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O3/c1-12-10-14(19-22-12)18-16(21)9-5-8-15(20)17-11-13-6-3-2-4-7-13/h2-4,6-7,10H,5,8-9,11H2,1H3,(H,17,20)(H,18,19,21).
What are the key properties of N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide?
N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide has a molecular weight of 301.35 g/mol, XLogP of 2.41, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N'-(5-methyl-1,2-oxazol-3-yl)pentanediamide is sourced from PubChem (CID 3153700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).