About 2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole
2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole (PubChem CID 31537210) has the molecular formula C13H17N5S
and a molecular weight of 275.38 g/mol. Its IUPAC name is 2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole |
| PubChem CID | 31537210 |
| Molecular Formula | C13H17N5S |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole |
| SMILES | Cc1cc(C)nc(N2CCN(c3nccs3)CC2)n1 |
| InChI | InChI=1S/C13H17N5S/c1-10-9-11(2)16-12(15-10)17-4-6-18(7-5-17)13-14-3-8-19-13/h3,8-9H,4-7H2,1-2H3 |
| InChIKey | JANTXXVNTRSBEF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole?
The IUPAC name of 2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole (CID 31537210) is 2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole.
What is the SMILES notation for 2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole?
The canonical SMILES for 2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole is Cc1cc(C)nc(N2CCN(c3nccs3)CC2)n1.
What is the InChIKey of 2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole?
The InChIKey is JANTXXVNTRSBEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5S/c1-10-9-11(2)16-12(15-10)17-4-6-18(7-5-17)13-14-3-8-19-13/h3,8-9H,4-7H2,1-2H3.
What are the key properties of 2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole?
2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole has a molecular weight of 275.38 g/mol, XLogP of 1.88, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1,3-thiazole is sourced from PubChem (CID 31537210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).