About 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide
2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide (PubChem CID 3153989) has the molecular formula C7H11N3O2S
and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide.
Molecular Properties
| Compound Name | 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide |
| PubChem CID | 3153989 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide |
| SMILES | CCNC(=O)CC1SC(N)=NC1=O |
| InChI | InChI=1S/C7H11N3O2S/c1-2-9-5(11)3-4-6(12)10-7(8)13-4/h4H,2-3H2,1H3,(H,9,11)(H2,8,10,12) |
| InChIKey | QRUSFYPMTHMDIU-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide?
The IUPAC name of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide (CID 3153989) is 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide.
What is the SMILES notation for 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide?
The canonical SMILES for 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide is CCNC(=O)CC1SC(N)=NC1=O.
What is the InChIKey of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide?
The InChIKey is QRUSFYPMTHMDIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2S/c1-2-9-5(11)3-4-6(12)10-7(8)13-4/h4H,2-3H2,1H3,(H,9,11)(H2,8,10,12).
What are the key properties of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide?
2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide has a molecular weight of 201.25 g/mol, XLogP of -0.53, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-4-oxo-1,3-thiazol-5-yl)-N-ethylacetamide is sourced from PubChem (CID 3153989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).