C17H18N4O4S — CID 31540328
(1R,2R)-2-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-(4-nitrophenyl)propane-1,3-diol (PubChem CID 31540328) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is (1R,2R)-2-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-(4-nitrophenyl)propane-1,3-diol.
| Compound Name | (1R,2R)-2-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-(4-nitrophenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 31540328 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (1R,2R)-2-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-1-(4-nitrophenyl)propane-1,3-diol |
| SMILES | CCc1cc2c(N[C@H](CO)[C@H](O)c3ccc([N+](=O)[O-])cc3)ncnc2s1 |
| InChI | InChI=1S/C17H18N4O4S/c1-2-12-7-13-16(18-9-19-17(13)26-12)20-14(8-22)15(23)10-3-5-11(6-4-10)21(24)25/h3-7,9,14-15,22-23H,2,8H2,1H3,(H,18,19,20)/t14-,15-/m1/s1 |
| InChIKey | AQQIGBDKEACOEU-HUUCEWRRSA-N |
| XLogP | 2.67 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|