About 1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one
1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one (PubChem CID 3154117) has the molecular formula C23H25NO5
and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one.
Molecular Properties
| Compound Name | 1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one |
| PubChem CID | 3154117 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one |
| SMILES | COc1cc(C2C(C(=O)C(C)(C)C)=C(O)C(=O)N2Cc2ccccc2)ccc1O |
| InChI | InChI=1S/C23H25NO5/c1-23(2,3)21(27)18-19(15-10-11-16(25)17(12-15)29-4)24(22(28)20(18)26)13-14-8-6-5-7-9-14/h5-12,19,25-26H,13H2,1-4H3 |
| InChIKey | OJPPNVZAWJCEPA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one?
The IUPAC name of 1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one (CID 3154117) is 1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one.
What is the SMILES notation for 1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one?
The canonical SMILES for 1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one is COc1cc(C2C(C(=O)C(C)(C)C)=C(O)C(=O)N2Cc2ccccc2)ccc1O.
What is the InChIKey of 1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one?
The InChIKey is OJPPNVZAWJCEPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO5/c1-23(2,3)21(27)18-19(15-10-11-16(25)17(12-15)29-4)24(22(28)20(18)26)13-14-8-6-5-7-9-14/h5-12,19,25-26H,13H2,1-4H3.
What are the key properties of 1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one?
1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one has a molecular weight of 395.46 g/mol, XLogP of 3.91, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-(2,2-dimethylpropanoyl)-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-pyrrol-5-one is sourced from PubChem (CID 3154117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).