C20H19FN2O5 — CID 3154131
4-[(4-fluorophenyl)-hydroxymethylidene]-1-[2-(2-hydroxyethoxy)ethyl]-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 3154131) has the molecular formula C20H19FN2O5 and a molecular weight of 386.38 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)-hydroxymethylidene]-1-[2-(2-hydroxyethoxy)ethyl]-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | 4-[(4-fluorophenyl)-hydroxymethylidene]-1-[2-(2-hydroxyethoxy)ethyl]-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3154131 |
| Molecular Formula | C20H19FN2O5 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-[(4-fluorophenyl)-hydroxymethylidene]-1-[2-(2-hydroxyethoxy)ethyl]-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCOCCO)C(c2cccnc2)C1=C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H19FN2O5/c21-15-5-3-13(4-6-15)18(25)16-17(14-2-1-7-22-12-14)23(20(27)19(16)26)8-10-28-11-9-24/h1-7,12,17,24-25H,8-11H2 |
| InChIKey | CHGQUHOWJAZOCT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|