About 2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine
2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine (PubChem CID 3154154) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine.
Molecular Properties
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine |
| PubChem CID | 3154154 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine |
| SMILES | COc1ccc(Cn2nccc2N)cc1OC |
| InChI | InChI=1S/C12H15N3O2/c1-16-10-4-3-9(7-11(10)17-2)8-15-12(13)5-6-14-15/h3-7H,8,13H2,1-2H3 |
| InChIKey | DZRCUBRTSCVVQJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine?
The IUPAC name of 2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine (CID 3154154) is 2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine.
What is the SMILES notation for 2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine?
The canonical SMILES for 2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine is COc1ccc(Cn2nccc2N)cc1OC.
What is the InChIKey of 2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine?
The InChIKey is DZRCUBRTSCVVQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2/c1-16-10-4-3-9(7-11(10)17-2)8-15-12(13)5-6-14-15/h3-7H,8,13H2,1-2H3.
What are the key properties of 2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine?
2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine has a molecular weight of 233.27 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dimethoxyphenyl)methyl]pyrazol-3-amine is sourced from PubChem (CID 3154154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).