2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid

C8H12N2O4 — CID 3154174

IUPAC2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid
SMILESCC(C(=O)O)N1C(=O)NC(C)(C)C1=O
InChIInChI=1S/C8H12N2O4/c1-4(5(11)12)10-6(13)8(2,3)9-7(10)14/h4H,1-3H3,(H,9,14)(H,11,12)
InChIKeySSOROUYGIXEUHC-UHFFFAOYSA-N
MW200.19 g/mol
LogP-0.21
Rot. Bonds2

About 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid

2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid (PubChem CID 3154174) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid.

Molecular Properties

Compound Name2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid
PubChem CID3154174
Molecular FormulaC8H12N2O4
Molecular Weight200.19 g/mol
Exact Mass200.08
IUPAC Name2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid
SMILESCC(C(=O)O)N1C(=O)NC(C)(C)C1=O
InChIInChI=1S/C8H12N2O4/c1-4(5(11)12)10-6(13)8(2,3)9-7(10)14/h4H,1-3H3,(H,9,14)(H,11,12)
InChIKeySSOROUYGIXEUHC-UHFFFAOYSA-N
XLogP-0.21
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.19
LogP ≤ 5-0.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydantoin', 'substructure': 'N/A'}

Analyze 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid?
The IUPAC name of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid (CID 3154174) is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid.
What is the SMILES notation for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid?
The canonical SMILES for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid is CC(C(=O)O)N1C(=O)NC(C)(C)C1=O.
What is the InChIKey of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid?
The InChIKey is SSOROUYGIXEUHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4/c1-4(5(11)12)10-6(13)8(2,3)9-7(10)14/h4H,1-3H3,(H,9,14)(H,11,12).
What are the key properties of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid?
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid has a molecular weight of 200.19 g/mol, XLogP of -0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid is sourced from PubChem (CID 3154174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).