2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid

C11H16N2O4 — CID 3154204

IUPAC2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid
SMILESCCOc1nc(C)c(CC(=O)O)c(OCC)n1
InChIInChI=1S/C11H16N2O4/c1-4-16-10-8(6-9(14)15)7(3)12-11(13-10)17-5-2/h4-6H2,1-3H3,(H,14,15)
InChIKeyFHNYGYRFWUNOGY-UHFFFAOYSA-N
MW240.26 g/mol
LogP1.21
Rot. Bonds6

About 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid

2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid (PubChem CID 3154204) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid.

Molecular Properties

Compound Name2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid
PubChem CID3154204
Molecular FormulaC11H16N2O4
Molecular Weight240.26 g/mol
Exact Mass240.11
IUPAC Name2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid
SMILESCCOc1nc(C)c(CC(=O)O)c(OCC)n1
InChIInChI=1S/C11H16N2O4/c1-4-16-10-8(6-9(14)15)7(3)12-11(13-10)17-5-2/h4-6H2,1-3H3,(H,14,15)
InChIKeyFHNYGYRFWUNOGY-UHFFFAOYSA-N
XLogP1.21
TPSA81.54 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.26
LogP ≤ 51.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid?
The IUPAC name of 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid (CID 3154204) is 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid.
What is the SMILES notation for 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid?
The canonical SMILES for 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid is CCOc1nc(C)c(CC(=O)O)c(OCC)n1.
What is the InChIKey of 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid?
The InChIKey is FHNYGYRFWUNOGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4/c1-4-16-10-8(6-9(14)15)7(3)12-11(13-10)17-5-2/h4-6H2,1-3H3,(H,14,15).
What are the key properties of 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid?
2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid has a molecular weight of 240.26 g/mol, XLogP of 1.21, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetic acid is sourced from PubChem (CID 3154204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).