About N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine
N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 3154229) has the molecular formula C12H19FN2
and a molecular weight of 210.30 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine |
| PubChem CID | 3154229 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCc1ccccc1F |
| InChI | InChI=1S/C12H19FN2/c1-15(2)9-5-8-14-10-11-6-3-4-7-12(11)13/h3-4,6-7,14H,5,8-10H2,1-2H3 |
| InChIKey | XXSQJRPPTRFIGY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine?
The IUPAC name of N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine (CID 3154229) is N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine.
What is the SMILES notation for N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine?
The canonical SMILES for N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine is CN(C)CCCNCc1ccccc1F.
What is the InChIKey of N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine?
The InChIKey is XXSQJRPPTRFIGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19FN2/c1-15(2)9-5-8-14-10-11-6-3-4-7-12(11)13/h3-4,6-7,14H,5,8-10H2,1-2H3.
What are the key properties of N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine?
N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine has a molecular weight of 210.30 g/mol, XLogP of 1.87, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-fluorophenyl)methyl]-N',N'-dimethylpropane-1,3-diamine is sourced from PubChem (CID 3154229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).