About 5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione
5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione (PubChem CID 3154244) has the molecular formula C14H23N3O2
and a molecular weight of 265.36 g/mol. Its IUPAC name is 5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 3154244 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione |
| SMILES | CCCC1CC(C)(C)CCN1c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H23N3O2/c1-4-5-10-8-14(2,3)6-7-17(10)11-9-15-13(19)16-12(11)18/h9-10H,4-8H2,1-3H3,(H2,15,16,18,19) |
| InChIKey | XVEWYGVNVUXLFZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione (CID 3154244) is 5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione is CCCC1CC(C)(C)CCN1c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of 5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione?
The InChIKey is XVEWYGVNVUXLFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2/c1-4-5-10-8-14(2,3)6-7-17(10)11-9-15-13(19)16-12(11)18/h9-10H,4-8H2,1-3H3,(H2,15,16,18,19).
What are the key properties of 5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione?
5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione has a molecular weight of 265.36 g/mol, XLogP of 1.86, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,4-dimethyl-2-propylpiperidin-1-yl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 3154244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).