C13H11N3O4 — CID 3154285
N-benzyl-3,4-dinitroaniline (PubChem CID 3154285) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is N-benzyl-3,4-dinitroaniline.
| Compound Name | N-benzyl-3,4-dinitroaniline |
|---|---|
| PubChem CID | 3154285 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | N-benzyl-3,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(NCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11N3O4/c17-15(18)12-7-6-11(8-13(12)16(19)20)14-9-10-4-2-1-3-5-10/h1-8,14H,9H2 |
| InChIKey | ZBWJTKSSDSNBSR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|