C10H7FN2O3 — CID 3154313
1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 3154313) has the molecular formula C10H7FN2O3 and a molecular weight of 222.18 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3154313 |
| Molecular Formula | C10H7FN2O3 |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 1-(3-fluorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1CC(=O)N(c2cccc(F)c2)C(=O)N1 |
| InChI | InChI=1S/C10H7FN2O3/c11-6-2-1-3-7(4-6)13-9(15)5-8(14)12-10(13)16/h1-4H,5H2,(H,12,14,16) |
| InChIKey | AMIMXOMZGDENSD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|