C19H20FN5O2 — CID 3154583
7-(3,4-dimethoxyphenyl)-5-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 3154583) has the molecular formula C19H20FN5O2 and a molecular weight of 369.40 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-5-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 7-(3,4-dimethoxyphenyl)-5-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 3154583 |
| Molecular Formula | C19H20FN5O2 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-5-(4-fluorophenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | COc1ccc(C2CC(c3ccc(F)cc3)Nc3nc(N)nn32)cc1OC |
| InChI | InChI=1S/C19H20FN5O2/c1-26-16-8-5-12(9-17(16)27-2)15-10-14(11-3-6-13(20)7-4-11)22-19-23-18(21)24-25(15)19/h3-9,14-15H,10H2,1-2H3,(H3,21,22,23,24) |
| InChIKey | YSZDYLRQRYNETL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |