C17H16FNO — CID 3154691
8-fluoro-4-phenyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline (PubChem CID 3154691) has the molecular formula C17H16FNO and a molecular weight of 269.32 g/mol. Its IUPAC name is 8-fluoro-4-phenyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline.
| Compound Name | 8-fluoro-4-phenyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 3154691 |
| Molecular Formula | C17H16FNO |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 8-fluoro-4-phenyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
| SMILES | Fc1ccc2c(c1)C1OCCC1C(c1ccccc1)N2 |
| InChI | InChI=1S/C17H16FNO/c18-12-6-7-15-14(10-12)17-13(8-9-20-17)16(19-15)11-4-2-1-3-5-11/h1-7,10,13,16-17,19H,8-9H2 |
| InChIKey | AECRXVHTIRYSNF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |