C24H27N5 — CID 3154794
6-amino-8-(4-tert-butylphenyl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 3154794) has the molecular formula C24H27N5 and a molecular weight of 385.52 g/mol. Its IUPAC name is 6-amino-8-(4-tert-butylphenyl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | 6-amino-8-(4-tert-butylphenyl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 3154794 |
| Molecular Formula | C24H27N5 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 6-amino-8-(4-tert-butylphenyl)-2-ethyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | CCN1CC=C2C(C#N)=C(N)C(C#N)(C#N)C(c3ccc(C(C)(C)C)cc3)C2C1 |
| InChI | InChI=1S/C24H27N5/c1-5-29-11-10-18-19(12-25)22(28)24(14-26,15-27)21(20(18)13-29)16-6-8-17(9-7-16)23(2,3)4/h6-10,20-21H,5,11,13,28H2,1-4H3 |
| InChIKey | KPSQNEAHAHLMMD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|