C19H21NS — CID 5284550
View drug profile → dosulepin(3E)-3-(6H-benzo[c][1]benzothiepin-11-ylidene)-N,N-dimethylpropan-1-amine (PubChem CID 5284550) has the molecular formula C19H21NS and a molecular weight of 295.45 g/mol. Its IUPAC name is (3E)-3-(6H-benzo[c][1]benzothiepin-11-ylidene)-N,N-dimethylpropan-1-amine.
| Compound Name | (3E)-3-(6H-benzo[c][1]benzothiepin-11-ylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 5284550 |
| Molecular Formula | C19H21NS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (3E)-3-(6H-benzo[c][1]benzothiepin-11-ylidene)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CC/C=C1\c2ccccc2CSc2ccccc21 |
| InChI | InChI=1S/C19H21NS/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19/h3-6,8-12H,7,13-14H2,1-2H3/b17-11+ |
| InChIKey | PHTUQLWOUWZIMZ-GZTJUZNOSA-N |
| XLogP | 4.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |