About N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide
N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide (PubChem CID 3155182) has the molecular formula C15H16ClN3OS
and a molecular weight of 321.83 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide |
| PubChem CID | 3155182 |
| Molecular Formula | C15H16ClN3OS |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide |
| SMILES | Cc1cc(C)nc(SCCC(=O)Nc2ccccc2Cl)n1 |
| InChI | InChI=1S/C15H16ClN3OS/c1-10-9-11(2)18-15(17-10)21-8-7-14(20)19-13-6-4-3-5-12(13)16/h3-6,9H,7-8H2,1-2H3,(H,19,20) |
| InChIKey | OPEVOZBFWITEOK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide?
The IUPAC name of N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide (CID 3155182) is N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide.
What is the SMILES notation for N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide?
The canonical SMILES for N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide is Cc1cc(C)nc(SCCC(=O)Nc2ccccc2Cl)n1.
What is the InChIKey of N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide?
The InChIKey is OPEVOZBFWITEOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClN3OS/c1-10-9-11(2)18-15(17-10)21-8-7-14(20)19-13-6-4-3-5-12(13)16/h3-6,9H,7-8H2,1-2H3,(H,19,20).
What are the key properties of N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide?
N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide has a molecular weight of 321.83 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropanamide is sourced from PubChem (CID 3155182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).