C13H15N3O6 — CID 31556979
[(2S)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] 2-(2,5-dioxopyrrolidin-1-yl)acetate (PubChem CID 31556979) has the molecular formula C13H15N3O6 and a molecular weight of 309.28 g/mol. Its IUPAC name is [(2S)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] 2-(2,5-dioxopyrrolidin-1-yl)acetate.
| Compound Name | [(2S)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] 2-(2,5-dioxopyrrolidin-1-yl)acetate |
|---|---|
| PubChem CID | 31556979 |
| Molecular Formula | C13H15N3O6 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | [(2S)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] 2-(2,5-dioxopyrrolidin-1-yl)acetate |
| SMILES | Cc1cc(NC(=O)[C@H](C)OC(=O)CN2C(=O)CCC2=O)no1 |
| InChI | InChI=1S/C13H15N3O6/c1-7-5-9(15-22-7)14-13(20)8(2)21-12(19)6-16-10(17)3-4-11(16)18/h5,8H,3-4,6H2,1-2H3,(H,14,15,20)/t8-/m0/s1 |
| InChIKey | ROTBIUVOSZJOBL-QMMMGPOBSA-N |
| XLogP | 0.00 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|