About 9-chloro-6-methylindolo[3,2-b]quinoxaline
9-chloro-6-methylindolo[3,2-b]quinoxaline (PubChem CID 3155707) has the molecular formula C15H10ClN3
and a molecular weight of 267.72 g/mol. Its IUPAC name is 9-chloro-6-methylindolo[3,2-b]quinoxaline.
Molecular Properties
| Compound Name | 9-chloro-6-methylindolo[3,2-b]quinoxaline |
| PubChem CID | 3155707 |
| Molecular Formula | C15H10ClN3 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 9-chloro-6-methylindolo[3,2-b]quinoxaline |
| SMILES | Cn1c2ccc(Cl)cc2c2nc3ccccc3nc21 |
| InChI | InChI=1S/C15H10ClN3/c1-19-13-7-6-9(16)8-10(13)14-15(19)18-12-5-3-2-4-11(12)17-14/h2-8H,1H3 |
| InChIKey | NXJNINUNSFIGJN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-chloro-6-methylindolo[3,2-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-6-methylindolo[3,2-b]quinoxaline?
The IUPAC name of 9-chloro-6-methylindolo[3,2-b]quinoxaline (CID 3155707) is 9-chloro-6-methylindolo[3,2-b]quinoxaline.
What is the SMILES notation for 9-chloro-6-methylindolo[3,2-b]quinoxaline?
The canonical SMILES for 9-chloro-6-methylindolo[3,2-b]quinoxaline is Cn1c2ccc(Cl)cc2c2nc3ccccc3nc21.
What is the InChIKey of 9-chloro-6-methylindolo[3,2-b]quinoxaline?
The InChIKey is NXJNINUNSFIGJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClN3/c1-19-13-7-6-9(16)8-10(13)14-15(19)18-12-5-3-2-4-11(12)17-14/h2-8H,1H3.
What are the key properties of 9-chloro-6-methylindolo[3,2-b]quinoxaline?
9-chloro-6-methylindolo[3,2-b]quinoxaline has a molecular weight of 267.72 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-6-methylindolo[3,2-b]quinoxaline is sourced from PubChem (CID 3155707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).