C12H13N3O3S — CID 3155756
2-(N-(2,4-dioxo-1,3-thiazolidin-5-yl)-3-methylanilino)acetamide (PubChem CID 3155756) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-(N-(2,4-dioxo-1,3-thiazolidin-5-yl)-3-methylanilino)acetamide.
| Compound Name | 2-(N-(2,4-dioxo-1,3-thiazolidin-5-yl)-3-methylanilino)acetamide |
|---|---|
| PubChem CID | 3155756 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-(N-(2,4-dioxo-1,3-thiazolidin-5-yl)-3-methylanilino)acetamide |
| SMILES | Cc1cccc(N(CC(N)=O)C2SC(=O)NC2=O)c1 |
| InChI | InChI=1S/C12H13N3O3S/c1-7-3-2-4-8(5-7)15(6-9(13)16)11-10(17)14-12(18)19-11/h2-5,11H,6H2,1H3,(H2,13,16)(H,14,17,18) |
| InChIKey | ISLUSJLNYRXMBD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|