C15H18N2O3S — CID 3155763
2-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-yl)-N-(2-methylphenyl)acetamide (PubChem CID 3155763) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-yl)-N-(2-methylphenyl)acetamide.
| Compound Name | 2-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-yl)-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 3155763 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-(2,4-dioxo-3-propyl-1,3-thiazolidin-5-yl)-N-(2-methylphenyl)acetamide |
| SMILES | CCCN1C(=O)SC(CC(=O)Nc2ccccc2C)C1=O |
| InChI | InChI=1S/C15H18N2O3S/c1-3-8-17-14(19)12(21-15(17)20)9-13(18)16-11-7-5-4-6-10(11)2/h4-7,12H,3,8-9H2,1-2H3,(H,16,18) |
| InChIKey | RDJSVOYBFYVOMJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|