C21H27N5O2 — CID 31559652
3-[3-[(1-benzylpyrazol-4-yl)methylamino]propyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 31559652) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[3-[(1-benzylpyrazol-4-yl)methylamino]propyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[3-[(1-benzylpyrazol-4-yl)methylamino]propyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 31559652 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 3-[3-[(1-benzylpyrazol-4-yl)methylamino]propyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)N1CCCNCc1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H27N5O2/c27-19-21(9-4-5-10-21)24-20(28)26(19)12-6-11-22-13-18-14-23-25(16-18)15-17-7-2-1-3-8-17/h1-3,7-8,14,16,22H,4-6,9-13,15H2,(H,24,28) |
| InChIKey | WFFYBQYKJSJNNX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|