C23H23N5O2 — CID 3156188
methyl 4-(6-amino-5,5,7-tricyano-2-propyl-1,3,8,8a-tetrahydroisoquinolin-8-yl)benzoate (PubChem CID 3156188) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is methyl 4-(6-amino-5,5,7-tricyano-2-propyl-1,3,8,8a-tetrahydroisoquinolin-8-yl)benzoate.
| Compound Name | methyl 4-(6-amino-5,5,7-tricyano-2-propyl-1,3,8,8a-tetrahydroisoquinolin-8-yl)benzoate |
|---|---|
| PubChem CID | 3156188 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | methyl 4-(6-amino-5,5,7-tricyano-2-propyl-1,3,8,8a-tetrahydroisoquinolin-8-yl)benzoate |
| SMILES | CCCN1CC=C2C(C1)C(c1ccc(C(=O)OC)cc1)C(C#N)=C(N)C2(C#N)C#N |
| InChI | InChI=1S/C23H23N5O2/c1-3-9-28-10-8-19-18(12-28)20(15-4-6-16(7-5-15)22(29)30-2)17(11-24)21(27)23(19,13-25)14-26/h4-8,18,20H,3,9-10,12,27H2,1-2H3 |
| InChIKey | USDIPFAPKZSUDR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|