C18H13FN4S — CID 3156527
6-amino-8-(4-fluorophenyl)-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile (PubChem CID 3156527) has the molecular formula C18H13FN4S and a molecular weight of 336.40 g/mol. Its IUPAC name is 6-amino-8-(4-fluorophenyl)-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile.
| Compound Name | 6-amino-8-(4-fluorophenyl)-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 3156527 |
| Molecular Formula | C18H13FN4S |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 6-amino-8-(4-fluorophenyl)-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)C(c2ccc(F)cc2)C2CSCC=C12 |
| InChI | InChI=1S/C18H13FN4S/c19-12-3-1-11(2-4-12)16-15-8-24-6-5-13(15)14(7-20)17(23)18(16,9-21)10-22/h1-5,15-16H,6,8,23H2 |
| InChIKey | OWRZYFCVHSQAEN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|