C15H13NO4 — CID 3156655
9,11,11-trimethyl-3,5-dioxa-12-azatetracyclo[6.6.1.02,6.012,15]pentadeca-1(15),2(6),7,9-tetraene-13,14-dione (PubChem CID 3156655) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 9,11,11-trimethyl-3,5-dioxa-12-azatetracyclo[6.6.1.02,6.012,15]pentadeca-1(15),2(6),7,9-tetraene-13,14-dione.
| Compound Name | 9,11,11-trimethyl-3,5-dioxa-12-azatetracyclo[6.6.1.02,6.012,15]pentadeca-1(15),2(6),7,9-tetraene-13,14-dione |
|---|---|
| PubChem CID | 3156655 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 9,11,11-trimethyl-3,5-dioxa-12-azatetracyclo[6.6.1.02,6.012,15]pentadeca-1(15),2(6),7,9-tetraene-13,14-dione |
| SMILES | CC1=CC(C)(C)N2C(=O)C(=O)c3c4c(cc1c32)OCO4 |
| InChI | InChI=1S/C15H13NO4/c1-7-5-15(2,3)16-11-8(7)4-9-13(20-6-19-9)10(11)12(17)14(16)18/h4-5H,6H2,1-3H3 |
| InChIKey | PGWCCJVOSXQDPC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|