About N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide
N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide (PubChem CID 3156706) has the molecular formula C15H21N3O2
and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide.
Molecular Properties
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide |
| PubChem CID | 3156706 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide |
| SMILES | CCN1CCCC1CNC(=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H21N3O2/c1-2-18-10-6-9-13(18)11-16-14(19)15(20)17-12-7-4-3-5-8-12/h3-5,7-8,13H,2,6,9-11H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | RVGUQPGNMZYGQO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide?
The IUPAC name of N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide (CID 3156706) is N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide.
What is the SMILES notation for N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide?
The canonical SMILES for N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide is CCN1CCCC1CNC(=O)C(=O)Nc1ccccc1.
What is the InChIKey of N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide?
The InChIKey is RVGUQPGNMZYGQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O2/c1-2-18-10-6-9-13(18)11-16-14(19)15(20)17-12-7-4-3-5-8-12/h3-5,7-8,13H,2,6,9-11H2,1H3,(H,16,19)(H,17,20).
What are the key properties of N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide?
N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide has a molecular weight of 275.35 g/mol, XLogP of 1.23, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-phenyloxamide is sourced from PubChem (CID 3156706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).