About N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide
N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide (PubChem CID 3156744) has the molecular formula C15H20FN3O2
and a molecular weight of 293.34 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide.
Molecular Properties
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide |
| PubChem CID | 3156744 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide |
| SMILES | CCN1CCCC1CNC(=O)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C15H20FN3O2/c1-2-19-9-5-6-11(19)10-17-14(20)15(21)18-13-8-4-3-7-12(13)16/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | RVOVRCWOQVWGCP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide?
The IUPAC name of N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide (CID 3156744) is N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide.
What is the SMILES notation for N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide?
The canonical SMILES for N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide is CCN1CCCC1CNC(=O)C(=O)Nc1ccccc1F.
What is the InChIKey of N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide?
The InChIKey is RVOVRCWOQVWGCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FN3O2/c1-2-19-9-5-6-11(19)10-17-14(20)15(21)18-13-8-4-3-7-12(13)16/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H,17,20)(H,18,21).
What are the key properties of N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide?
N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide has a molecular weight of 293.34 g/mol, XLogP of 1.36, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-ethylpyrrolidin-2-yl)methyl]-N'-(2-fluorophenyl)oxamide is sourced from PubChem (CID 3156744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).