C10H15NO2 — CID 3156818
N-(furan-3-ylmethyl)-1-(oxolan-2-yl)methanamine (PubChem CID 3156818) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-1-(oxolan-2-yl)methanamine.
| Compound Name | N-(furan-3-ylmethyl)-1-(oxolan-2-yl)methanamine |
|---|---|
| PubChem CID | 3156818 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-(furan-3-ylmethyl)-1-(oxolan-2-yl)methanamine |
| SMILES | c1cc(CNCC2CCCO2)co1 |
| InChI | InChI=1S/C10H15NO2/c1-2-10(13-4-1)7-11-6-9-3-5-12-8-9/h3,5,8,10-11H,1-2,4,6-7H2 |
| InChIKey | WBDDEGSGJCEMOY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |