C17H22N2O5 — CID 3156868
N-[2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl]furan-2-carboxamide (PubChem CID 3156868) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is N-[2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3156868 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-[2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl]furan-2-carboxamide |
| SMILES | COc1cc(OC)c(OC)cc1CNCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C17H22N2O5/c1-21-14-10-16(23-3)15(22-2)9-12(14)11-18-6-7-19-17(20)13-5-4-8-24-13/h4-5,8-10,18H,6-7,11H2,1-3H3,(H,19,20) |
| InChIKey | LHXRIYMRVQLMQD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|