C12H16ClN7S — CID 3157003
6-(2-chloro-6-methylpyrimidin-4-yl)sulfanyl-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine (PubChem CID 3157003) has the molecular formula C12H16ClN7S and a molecular weight of 325.83 g/mol. Its IUPAC name is 6-(2-chloro-6-methylpyrimidin-4-yl)sulfanyl-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-chloro-6-methylpyrimidin-4-yl)sulfanyl-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3157003 |
| Molecular Formula | C12H16ClN7S |
| Molecular Weight | 325.83 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 6-(2-chloro-6-methylpyrimidin-4-yl)sulfanyl-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(Sc2nc(N(C)C)nc(N(C)C)n2)nc(Cl)n1 |
| InChI | InChI=1S/C12H16ClN7S/c1-7-6-8(15-9(13)14-7)21-12-17-10(19(2)3)16-11(18-12)20(4)5/h6H,1-5H3 |
| InChIKey | WFNAFZWXZBLMLL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.83 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |