About 2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine
2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine (PubChem CID 3157019) has the molecular formula C11H12N4OS
and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine.
Molecular Properties
| Compound Name | 2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine |
| PubChem CID | 3157019 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine |
| SMILES | NC(N)=NC1=NC(=O)C(Cc2ccccc2)S1 |
| InChI | InChI=1S/C11H12N4OS/c12-10(13)15-11-14-9(16)8(17-11)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H4,12,13,14,15,16) |
| InChIKey | MVSGCLHOYSDVDM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine?
The IUPAC name of 2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine (CID 3157019) is 2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine.
What is the SMILES notation for 2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine?
The canonical SMILES for 2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine is NC(N)=NC1=NC(=O)C(Cc2ccccc2)S1.
What is the InChIKey of 2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine?
The InChIKey is MVSGCLHOYSDVDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4OS/c12-10(13)15-11-14-9(16)8(17-11)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H4,12,13,14,15,16).
What are the key properties of 2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine?
2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine has a molecular weight of 248.31 g/mol, XLogP of 0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-benzyl-4-oxo-1,3-thiazol-2-yl)guanidine is sourced from PubChem (CID 3157019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).